C20H26ClFN2O3S — CID 120649371
N-(3-aminopropyl)-N-benzyl-3-(4-fluorophenyl)sulfonylbutanamide;hydrochloride (PubChem CID 120649371) has the molecular formula C20H26ClFN2O3S and a molecular weight of 428.96 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-benzyl-3-(4-fluorophenyl)sulfonylbutanamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-N-benzyl-3-(4-fluorophenyl)sulfonylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 120649371 |
| Molecular Formula | C20H26ClFN2O3S |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-(3-aminopropyl)-N-benzyl-3-(4-fluorophenyl)sulfonylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)N(CCCN)Cc1ccccc1)S(=O)(=O)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C20H25FN2O3S.ClH/c1-16(27(25,26)19-10-8-18(21)9-11-19)14-20(24)23(13-5-12-22)15-17-6-3-2-4-7-17;/h2-4,6-11,16H,5,12-15,22H2,1H3;1H |
| InChIKey | CRKSQXMQLNNOBR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |