C16H26N2O — CID 107365679
N-(3-aminopropyl)-N-benzyl-2,3-dimethylbutanamide (PubChem CID 107365679) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-benzyl-2,3-dimethylbutanamide.
| Compound Name | N-(3-aminopropyl)-N-benzyl-2,3-dimethylbutanamide |
|---|---|
| PubChem CID | 107365679 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | N-(3-aminopropyl)-N-benzyl-2,3-dimethylbutanamide |
| SMILES | CC(C)C(C)C(=O)N(CCCN)Cc1ccccc1 |
| InChI | InChI=1S/C16H26N2O/c1-13(2)14(3)16(19)18(11-7-10-17)12-15-8-5-4-6-9-15/h4-6,8-9,13-14H,7,10-12,17H2,1-3H3 |
| InChIKey | BWPIRIWTTJYRSX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |