C18H22N2O — CID 107365954
N-(3-aminopropyl)-N-benzyl-4-methylbenzamide (PubChem CID 107365954) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-benzyl-4-methylbenzamide.
| Compound Name | N-(3-aminopropyl)-N-benzyl-4-methylbenzamide |
|---|---|
| PubChem CID | 107365954 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-(3-aminopropyl)-N-benzyl-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N(CCCN)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H22N2O/c1-15-8-10-17(11-9-15)18(21)20(13-5-12-19)14-16-6-3-2-4-7-16/h2-4,6-11H,5,12-14,19H2,1H3 |
| InChIKey | WIRFTGFHOVYNEJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |