C13H21N3O — CID 107366332
1-(3-aminopropyl)-1-benzyl-3,3-dimethylurea (PubChem CID 107366332) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-(3-aminopropyl)-1-benzyl-3,3-dimethylurea.
| Compound Name | 1-(3-aminopropyl)-1-benzyl-3,3-dimethylurea |
|---|---|
| PubChem CID | 107366332 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 1-(3-aminopropyl)-1-benzyl-3,3-dimethylurea |
| SMILES | CN(C)C(=O)N(CCCN)Cc1ccccc1 |
| InChI | InChI=1S/C13H21N3O/c1-15(2)13(17)16(10-6-9-14)11-12-7-4-3-5-8-12/h3-5,7-8H,6,9-11,14H2,1-2H3 |
| InChIKey | IDZZQFVRKKYQDA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |