C18H23N2O4P — CID 23877767
[4-[[3-aminopropyl(benzoyl)amino]methyl]phenyl]methylphosphonic acid (PubChem CID 23877767) has the molecular formula C18H23N2O4P and a molecular weight of 362.37 g/mol. Its IUPAC name is [4-[[3-aminopropyl(benzoyl)amino]methyl]phenyl]methylphosphonic acid.
| Compound Name | [4-[[3-aminopropyl(benzoyl)amino]methyl]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 23877767 |
| Molecular Formula | C18H23N2O4P |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | [4-[[3-aminopropyl(benzoyl)amino]methyl]phenyl]methylphosphonic acid |
| SMILES | NCCCN(Cc1ccc(CP(=O)(O)O)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H23N2O4P/c19-11-4-12-20(18(21)17-5-2-1-3-6-17)13-15-7-9-16(10-8-15)14-25(22,23)24/h1-3,5-10H,4,11-14,19H2,(H2,22,23,24) |
| InChIKey | ZTZSTMDBKWIVFV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|