C19H33N3O — CID 68737596
N,N-bis(6-aminohexyl)benzamide (PubChem CID 68737596) has the molecular formula C19H33N3O and a molecular weight of 319.49 g/mol. Its IUPAC name is N,N-bis(6-aminohexyl)benzamide.
| Compound Name | N,N-bis(6-aminohexyl)benzamide |
|---|---|
| PubChem CID | 68737596 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | N,N-bis(6-aminohexyl)benzamide |
| SMILES | NCCCCCCN(CCCCCCN)C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H33N3O/c20-14-8-1-3-10-16-22(17-11-4-2-9-15-21)19(23)18-12-6-5-7-13-18/h5-7,12-13H,1-4,8-11,14-17,20-21H2 |
| InChIKey | YRZYWJWMIVGYFV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|