C10H10N8O6 — CID 3335365
1-[3-nitro-5-[5-nitro-2-(2-oxopropyl)-1,2,4-triazol-3-yl]-1,2,4-triazol-1-yl]propan-2-one (PubChem CID 3335365) has the molecular formula C10H10N8O6 and a molecular weight of 338.24 g/mol. Its IUPAC name is 1-[3-nitro-5-[5-nitro-2-(2-oxopropyl)-1,2,4-triazol-3-yl]-1,2,4-triazol-1-yl]propan-2-one.
| Compound Name | 1-[3-nitro-5-[5-nitro-2-(2-oxopropyl)-1,2,4-triazol-3-yl]-1,2,4-triazol-1-yl]propan-2-one |
|---|---|
| PubChem CID | 3335365 |
| Molecular Formula | C10H10N8O6 |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1-[3-nitro-5-[5-nitro-2-(2-oxopropyl)-1,2,4-triazol-3-yl]-1,2,4-triazol-1-yl]propan-2-one |
| SMILES | CC(=O)Cn1nc([N+](=O)[O-])nc1-c1nc([N+](=O)[O-])nn1CC(C)=O |
| InChI | InChI=1S/C10H10N8O6/c1-5(19)3-15-7(11-9(13-15)17(21)22)8-12-10(18(23)24)14-16(8)4-6(2)20/h3-4H2,1-2H3 |
| InChIKey | DKFQXWPTSSQGGN-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 181.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|