C7H8N4O5 — CID 25270634
1-(2-methyl-4,5-dinitroimidazol-1-yl)propan-2-one (PubChem CID 25270634) has the molecular formula C7H8N4O5 and a molecular weight of 228.16 g/mol. Its IUPAC name is 1-(2-methyl-4,5-dinitroimidazol-1-yl)propan-2-one.
| Compound Name | 1-(2-methyl-4,5-dinitroimidazol-1-yl)propan-2-one |
|---|---|
| PubChem CID | 25270634 |
| Molecular Formula | C7H8N4O5 |
| Molecular Weight | 228.16 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 1-(2-methyl-4,5-dinitroimidazol-1-yl)propan-2-one |
| SMILES | CC(=O)Cn1c(C)nc([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H8N4O5/c1-4(12)3-9-5(2)8-6(10(13)14)7(9)11(15)16/h3H2,1-2H3 |
| InChIKey | HWTYMMVQHXOBIY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 121.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.16 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|