C7H9N4O4- — CID 7200415
2-[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]acetate (PubChem CID 7200415) has the molecular formula C7H9N4O4- and a molecular weight of 213.17 g/mol. Its IUPAC name is 2-[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]acetate.
| Compound Name | 2-[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]acetate |
|---|---|
| PubChem CID | 7200415 |
| Molecular Formula | C7H9N4O4- |
| Molecular Weight | 213.17 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2-[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]acetate |
| SMILES | Cc1nc([N+](=O)[O-])c(NCC(=O)[O-])n1C |
| InChI | InChI=1S/C7H10N4O4/c1-4-9-7(11(14)15)6(10(4)2)8-3-5(12)13/h8H,3H2,1-2H3,(H,12,13)/p-1 |
| InChIKey | KJTKPBACDDFPHU-UHFFFAOYSA-M |
| XLogP | -1.20 |
| TPSA | 113.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.17 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|