About 3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]oxolan-3-ol
3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]oxolan-3-ol (PubChem CID 103847711) has the molecular formula C10H16N4O4
and a molecular weight of 256.26 g/mol. Its IUPAC name is 3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]oxolan-3-ol.
Molecular Properties
| Compound Name | 3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]oxolan-3-ol |
| PubChem CID | 103847711 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]oxolan-3-ol |
| SMILES | Cc1nc([N+](=O)[O-])c(NCC2(O)CCOC2)n1C |
| InChI | InChI=1S/C10H16N4O4/c1-7-12-9(14(16)17)8(13(7)2)11-5-10(15)3-4-18-6-10/h11,15H,3-6H2,1-2H3 |
| InChIKey | OBLNPFARNBTVOG-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]oxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]oxolan-3-ol?
The IUPAC name of 3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]oxolan-3-ol (CID 103847711) is 3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]oxolan-3-ol.
What is the SMILES notation for 3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]oxolan-3-ol?
The canonical SMILES for 3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]oxolan-3-ol is Cc1nc([N+](=O)[O-])c(NCC2(O)CCOC2)n1C.
What is the InChIKey of 3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]oxolan-3-ol?
The InChIKey is OBLNPFARNBTVOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O4/c1-7-12-9(14(16)17)8(13(7)2)11-5-10(15)3-4-18-6-10/h11,15H,3-6H2,1-2H3.
What are the key properties of 3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]oxolan-3-ol?
3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]oxolan-3-ol has a molecular weight of 256.26 g/mol, XLogP of 0.20, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]oxolan-3-ol is sourced from PubChem (CID 103847711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).