C9H14N6O4 — CID 114143806
3-[[(6-hydrazinyl-5-nitropyrimidin-4-yl)amino]methyl]oxolan-3-ol (PubChem CID 114143806) has the molecular formula C9H14N6O4 and a molecular weight of 270.25 g/mol. Its IUPAC name is 3-[[(6-hydrazinyl-5-nitropyrimidin-4-yl)amino]methyl]oxolan-3-ol.
| Compound Name | 3-[[(6-hydrazinyl-5-nitropyrimidin-4-yl)amino]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 114143806 |
| Molecular Formula | C9H14N6O4 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 3-[[(6-hydrazinyl-5-nitropyrimidin-4-yl)amino]methyl]oxolan-3-ol |
| SMILES | NNc1ncnc(NCC2(O)CCOC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H14N6O4/c10-14-8-6(15(17)18)7(12-5-13-8)11-3-9(16)1-2-19-4-9/h5,16H,1-4,10H2,(H2,11,12,13,14) |
| InChIKey | XNGNLIULTPJDCN-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 148.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|