C12H22N4O3 — CID 103705201
3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]hexan-1-ol (PubChem CID 103705201) has the molecular formula C12H22N4O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]hexan-1-ol.
| Compound Name | 3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 103705201 |
| Molecular Formula | C12H22N4O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 3-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNc1c([N+](=O)[O-])nc(C)n1C |
| InChI | InChI=1S/C12H22N4O3/c1-4-5-10(6-7-17)8-13-11-12(16(18)19)14-9(2)15(11)3/h10,13,17H,4-8H2,1-3H3 |
| InChIKey | CBGSMPQGVWPOHQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|