C8H14N4O4 — CID 103696551
2-[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]propane-1,3-diol (PubChem CID 103696551) has the molecular formula C8H14N4O4 and a molecular weight of 230.22 g/mol. Its IUPAC name is 2-[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]propane-1,3-diol.
| Compound Name | 2-[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 103696551 |
| Molecular Formula | C8H14N4O4 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 2-[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]propane-1,3-diol |
| SMILES | Cc1nc([N+](=O)[O-])c(NC(CO)CO)n1C |
| InChI | InChI=1S/C8H14N4O4/c1-5-9-8(12(15)16)7(11(5)2)10-6(3-13)4-14/h6,10,13-14H,3-4H2,1-2H3 |
| InChIKey | OSXWHSGVLDGHBU-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|