C7H12N4O4 — CID 65314028
2-[(3-methyl-5-nitroimidazol-4-yl)amino]propane-1,3-diol (PubChem CID 65314028) has the molecular formula C7H12N4O4 and a molecular weight of 216.20 g/mol. Its IUPAC name is 2-[(3-methyl-5-nitroimidazol-4-yl)amino]propane-1,3-diol.
| Compound Name | 2-[(3-methyl-5-nitroimidazol-4-yl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 65314028 |
| Molecular Formula | C7H12N4O4 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-[(3-methyl-5-nitroimidazol-4-yl)amino]propane-1,3-diol |
| SMILES | Cn1cnc([N+](=O)[O-])c1NC(CO)CO |
| InChI | InChI=1S/C7H12N4O4/c1-10-4-8-6(11(14)15)7(10)9-5(2-12)3-13/h4-5,9,12-13H,2-3H2,1H3 |
| InChIKey | TYCPHZMMJPGDHC-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|