C12H16N4O2S — CID 103554809
2,3-dimethyl-5-nitro-N-(1-thiophen-2-ylpropyl)imidazol-4-amine (PubChem CID 103554809) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2,3-dimethyl-5-nitro-N-(1-thiophen-2-ylpropyl)imidazol-4-amine.
| Compound Name | 2,3-dimethyl-5-nitro-N-(1-thiophen-2-ylpropyl)imidazol-4-amine |
|---|---|
| PubChem CID | 103554809 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2,3-dimethyl-5-nitro-N-(1-thiophen-2-ylpropyl)imidazol-4-amine |
| SMILES | CCC(Nc1c([N+](=O)[O-])nc(C)n1C)c1cccs1 |
| InChI | InChI=1S/C12H16N4O2S/c1-4-9(10-6-5-7-19-10)14-11-12(16(17)18)13-8(2)15(11)3/h5-7,9,14H,4H2,1-3H3 |
| InChIKey | CJJCKDPXTVIQHM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|