C10H16N4O2 — CID 103554894
2,3-dimethyl-5-nitro-N-pent-4-en-2-ylimidazol-4-amine (PubChem CID 103554894) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2,3-dimethyl-5-nitro-N-pent-4-en-2-ylimidazol-4-amine.
| Compound Name | 2,3-dimethyl-5-nitro-N-pent-4-en-2-ylimidazol-4-amine |
|---|---|
| PubChem CID | 103554894 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2,3-dimethyl-5-nitro-N-pent-4-en-2-ylimidazol-4-amine |
| SMILES | C=CCC(C)Nc1c([N+](=O)[O-])nc(C)n1C |
| InChI | InChI=1S/C10H16N4O2/c1-5-6-7(2)11-9-10(14(15)16)12-8(3)13(9)4/h5,7,11H,1,6H2,2-4H3 |
| InChIKey | GKBLPRUULDJBJX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|