C9H11N5O3S — CID 106382209
4-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106382209) has the molecular formula C9H11N5O3S and a molecular weight of 269.29 g/mol. Its IUPAC name is 4-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106382209 |
| Molecular Formula | C9H11N5O3S |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 4-[[(2,3-dimethyl-5-nitroimidazol-4-yl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | Cc1nc([N+](=O)[O-])c(NCc2csc(=O)[nH]2)n1C |
| InChI | InChI=1S/C9H11N5O3S/c1-5-11-8(14(16)17)7(13(5)2)10-3-6-4-18-9(15)12-6/h4,10H,3H2,1-2H3,(H,12,15) |
| InChIKey | DZLVWEKSWDYBKC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|