About 4-[[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one
4-[[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106384288) has the molecular formula C9H11N7O3S
and a molecular weight of 297.30 g/mol. Its IUPAC name is 4-[[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-[[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one |
| PubChem CID | 106384288 |
| Molecular Formula | C9H11N7O3S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 4-[[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | Cc1nc(NN)nc(NCc2csc(=O)[nH]2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11N7O3S/c1-4-6(16(18)19)7(14-8(12-4)15-10)11-2-5-3-20-9(17)13-5/h3H,2,10H2,1H3,(H,13,17)(H2,11,12,14,15) |
| InChIKey | VOPGHIGREQXMCA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 151.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one?
The IUPAC name of 4-[[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one (CID 106384288) is 4-[[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one.
What is the SMILES notation for 4-[[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one?
The canonical SMILES for 4-[[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one is Cc1nc(NN)nc(NCc2csc(=O)[nH]2)c1[N+](=O)[O-].
What is the InChIKey of 4-[[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one?
The InChIKey is VOPGHIGREQXMCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N7O3S/c1-4-6(16(18)19)7(14-8(12-4)15-10)11-2-5-3-20-9(17)13-5/h3H,2,10H2,1H3,(H,13,17)(H2,11,12,14,15).
What are the key properties of 4-[[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one?
4-[[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one has a molecular weight of 297.30 g/mol, XLogP of 0.34, 5 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one is sourced from PubChem (CID 106384288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).