C8H12F2N6O3 — CID 114094055
1,1-difluoro-3-[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]propan-2-ol (PubChem CID 114094055) has the molecular formula C8H12F2N6O3 and a molecular weight of 278.22 g/mol. Its IUPAC name is 1,1-difluoro-3-[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]propan-2-ol.
| Compound Name | 1,1-difluoro-3-[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 114094055 |
| Molecular Formula | C8H12F2N6O3 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1,1-difluoro-3-[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]propan-2-ol |
| SMILES | Cc1nc(NN)nc(NCC(O)C(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H12F2N6O3/c1-3-5(16(18)19)7(14-8(13-3)15-11)12-2-4(17)6(9)10/h4,6,17H,2,11H2,1H3,(H2,12,13,14,15) |
| InChIKey | KBRBDRBUNQXVQV-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|