C10H18N6O3 — CID 114045068
2-hydrazinyl-N-(4-methoxybutan-2-yl)-6-methyl-5-nitropyrimidin-4-amine (PubChem CID 114045068) has the molecular formula C10H18N6O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-hydrazinyl-N-(4-methoxybutan-2-yl)-6-methyl-5-nitropyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-(4-methoxybutan-2-yl)-6-methyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 114045068 |
| Molecular Formula | C10H18N6O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-hydrazinyl-N-(4-methoxybutan-2-yl)-6-methyl-5-nitropyrimidin-4-amine |
| SMILES | COCCC(C)Nc1nc(NN)nc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H18N6O3/c1-6(4-5-19-3)12-9-8(16(17)18)7(2)13-10(14-9)15-11/h6H,4-5,11H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | NQSPZNXUKUIYEK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|