C10H18N6O3S — CID 106163701
3-[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol (PubChem CID 106163701) has the molecular formula C10H18N6O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol.
| Compound Name | 3-[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 106163701 |
| Molecular Formula | C10H18N6O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3-[(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol |
| SMILES | CSC(CO)C(C)Nc1nc(NN)nc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H18N6O3S/c1-5(7(4-17)20-3)12-9-8(16(18)19)6(2)13-10(14-9)15-11/h5,7,17H,4,11H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | HWPXYTVIRVFCRX-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|