C11H18N4O3S — CID 106163685
3-(3-hydrazinyl-2-nitroanilino)-2-methylsulfanylbutan-1-ol (PubChem CID 106163685) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is 3-(3-hydrazinyl-2-nitroanilino)-2-methylsulfanylbutan-1-ol.
| Compound Name | 3-(3-hydrazinyl-2-nitroanilino)-2-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 106163685 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-(3-hydrazinyl-2-nitroanilino)-2-methylsulfanylbutan-1-ol |
| SMILES | CSC(CO)C(C)Nc1cccc(NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H18N4O3S/c1-7(10(6-16)19-2)13-8-4-3-5-9(14-12)11(8)15(17)18/h3-5,7,10,13-14,16H,6,12H2,1-2H3 |
| InChIKey | LKXOXGHBRHFLSH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|