C11H20N6O2 — CID 114045065
N-(2,3-dimethylbutyl)-2-hydrazinyl-6-methyl-5-nitropyrimidin-4-amine (PubChem CID 114045065) has the molecular formula C11H20N6O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-(2,3-dimethylbutyl)-2-hydrazinyl-6-methyl-5-nitropyrimidin-4-amine.
| Compound Name | N-(2,3-dimethylbutyl)-2-hydrazinyl-6-methyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 114045065 |
| Molecular Formula | C11H20N6O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | N-(2,3-dimethylbutyl)-2-hydrazinyl-6-methyl-5-nitropyrimidin-4-amine |
| SMILES | Cc1nc(NN)nc(NCC(C)C(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H20N6O2/c1-6(2)7(3)5-13-10-9(17(18)19)8(4)14-11(15-10)16-12/h6-7H,5,12H2,1-4H3,(H2,13,14,15,16) |
| InChIKey | CKXNRHDAOBXQRK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|