About 2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine
2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine (PubChem CID 18801447) has the molecular formula C9H15N5O2
and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine |
| PubChem CID | 18801447 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine |
| SMILES | CCNc1nc(C)c([N+](=O)[O-])c(NCC)n1 |
| InChI | InChI=1S/C9H15N5O2/c1-4-10-8-7(14(15)16)6(3)12-9(13-8)11-5-2/h4-5H2,1-3H3,(H2,10,11,12,13) |
| InChIKey | OMCFSDHVVLERSO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine?
The IUPAC name of 2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine (CID 18801447) is 2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine.
What is the SMILES notation for 2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine?
The canonical SMILES for 2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine is CCNc1nc(C)c([N+](=O)[O-])c(NCC)n1.
What is the InChIKey of 2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine?
The InChIKey is OMCFSDHVVLERSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O2/c1-4-10-8-7(14(15)16)6(3)12-9(13-8)11-5-2/h4-5H2,1-3H3,(H2,10,11,12,13).
What are the key properties of 2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine?
2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine has a molecular weight of 225.25 g/mol, XLogP of 1.56, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine is sourced from PubChem (CID 18801447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).