C9H15N5O2 — CID 18801447
2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine (PubChem CID 18801447) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 18801447 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-N,4-N-diethyl-6-methyl-5-nitropyrimidine-2,4-diamine |
| SMILES | CCNc1nc(C)c([N+](=O)[O-])c(NCC)n1 |
| InChI | InChI=1S/C9H15N5O2/c1-4-10-8-7(14(15)16)6(3)12-9(13-8)11-5-2/h4-5H2,1-3H3,(H2,10,11,12,13) |
| InChIKey | OMCFSDHVVLERSO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|