C11H17N5O2 — CID 114102495
2-N,6-dimethyl-4-N-[(1-methylcyclopropyl)methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 114102495) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-N,6-dimethyl-4-N-[(1-methylcyclopropyl)methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N,6-dimethyl-4-N-[(1-methylcyclopropyl)methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 114102495 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 2-N,6-dimethyl-4-N-[(1-methylcyclopropyl)methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | CNc1nc(C)c([N+](=O)[O-])c(NCC2(C)CC2)n1 |
| InChI | InChI=1S/C11H17N5O2/c1-7-8(16(17)18)9(15-10(12-3)14-7)13-6-11(2)4-5-11/h4-6H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | XKVVMHMWOWNRKI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|