C8H10F3N5O3 — CID 114045195
[4-methyl-5-nitro-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-2-yl]hydrazine (PubChem CID 114045195) has the molecular formula C8H10F3N5O3 and a molecular weight of 281.19 g/mol. Its IUPAC name is [4-methyl-5-nitro-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-2-yl]hydrazine.
| Compound Name | [4-methyl-5-nitro-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 114045195 |
| Molecular Formula | C8H10F3N5O3 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | [4-methyl-5-nitro-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-2-yl]hydrazine |
| SMILES | Cc1nc(NN)nc(OC(C)C(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10F3N5O3/c1-3-5(16(17)18)6(14-7(13-3)15-12)19-4(2)8(9,10)11/h4H,12H2,1-2H3,(H,13,14,15) |
| InChIKey | LBUPCPLBBNHPPI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|