C10H16N6O3 — CID 114045121
1-(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)piperidin-4-ol (PubChem CID 114045121) has the molecular formula C10H16N6O3 and a molecular weight of 268.28 g/mol. Its IUPAC name is 1-(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)piperidin-4-ol.
| Compound Name | 1-(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 114045121 |
| Molecular Formula | C10H16N6O3 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1-(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)piperidin-4-ol |
| SMILES | Cc1nc(NN)nc(N2CCC(O)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H16N6O3/c1-6-8(16(18)19)9(13-10(12-6)14-11)15-4-2-7(17)3-5-15/h7,17H,2-5,11H2,1H3,(H,12,13,14) |
| InChIKey | TVWUHSPOIBZHCB-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|