C14H24N6O2 — CID 40540040
2-N-[(2R)-butan-2-yl]-6-(4-methylpiperidin-1-yl)-5-nitropyrimidine-2,4-diamine (PubChem CID 40540040) has the molecular formula C14H24N6O2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 2-N-[(2R)-butan-2-yl]-6-(4-methylpiperidin-1-yl)-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-[(2R)-butan-2-yl]-6-(4-methylpiperidin-1-yl)-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 40540040 |
| Molecular Formula | C14H24N6O2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2-N-[(2R)-butan-2-yl]-6-(4-methylpiperidin-1-yl)-5-nitropyrimidine-2,4-diamine |
| SMILES | CC[C@@H](C)Nc1nc(N)c([N+](=O)[O-])c(N2CCC(C)CC2)n1 |
| InChI | InChI=1S/C14H24N6O2/c1-4-10(3)16-14-17-12(15)11(20(21)22)13(18-14)19-7-5-9(2)6-8-19/h9-10H,4-8H2,1-3H3,(H3,15,16,17,18)/t10-/m1/s1 |
| InChIKey | BHRNBDYTTCSPHR-SNVBAGLBSA-N |
| XLogP | 2.41 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|