C15H28N7O2+ — CID 7523489
3-[[4-amino-6-(4-methylpiperidin-1-yl)-5-nitropyrimidin-2-yl]amino]propyl-dimethylazanium (PubChem CID 7523489) has the molecular formula C15H28N7O2+ and a molecular weight of 338.44 g/mol. Its IUPAC name is 3-[[4-amino-6-(4-methylpiperidin-1-yl)-5-nitropyrimidin-2-yl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[4-amino-6-(4-methylpiperidin-1-yl)-5-nitropyrimidin-2-yl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7523489 |
| Molecular Formula | C15H28N7O2+ |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 3-[[4-amino-6-(4-methylpiperidin-1-yl)-5-nitropyrimidin-2-yl]amino]propyl-dimethylazanium |
| SMILES | CC1CCN(c2nc(NCCC[NH+](C)C)nc(N)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H27N7O2/c1-11-5-9-21(10-6-11)14-12(22(23)24)13(16)18-15(19-14)17-7-4-8-20(2)3/h11H,4-10H2,1-3H3,(H3,16,17,18,19)/p+1 |
| InChIKey | SIXAAKXXKVHPRC-UHFFFAOYSA-O |
| XLogP | 0.15 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|