C16H30N7O2+ — CID 7529349
3-[(4-amino-5-nitro-6-piperidin-1-ylpyrimidin-2-yl)amino]propyl-diethylazanium (PubChem CID 7529349) has the molecular formula C16H30N7O2+ and a molecular weight of 352.46 g/mol. Its IUPAC name is 3-[(4-amino-5-nitro-6-piperidin-1-ylpyrimidin-2-yl)amino]propyl-diethylazanium.
| Compound Name | 3-[(4-amino-5-nitro-6-piperidin-1-ylpyrimidin-2-yl)amino]propyl-diethylazanium |
|---|---|
| PubChem CID | 7529349 |
| Molecular Formula | C16H30N7O2+ |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 3-[(4-amino-5-nitro-6-piperidin-1-ylpyrimidin-2-yl)amino]propyl-diethylazanium |
| SMILES | CC[NH+](CC)CCCNc1nc(N)c([N+](=O)[O-])c(N2CCCCC2)n1 |
| InChI | InChI=1S/C16H29N7O2/c1-3-21(4-2)10-8-9-18-16-19-14(17)13(23(24)25)15(20-16)22-11-6-5-7-12-22/h3-12H2,1-2H3,(H3,17,18,19,20)/p+1 |
| InChIKey | YVDUJTREQZIKSK-UHFFFAOYSA-O |
| XLogP | 0.68 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|