C12H22N7O3+ — CID 7179614
2-[[4-amino-6-(4-ethylpiperazin-4-ium-1-yl)-5-nitropyrimidin-2-yl]amino]ethanol (PubChem CID 7179614) has the molecular formula C12H22N7O3+ and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-[[4-amino-6-(4-ethylpiperazin-4-ium-1-yl)-5-nitropyrimidin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-amino-6-(4-ethylpiperazin-4-ium-1-yl)-5-nitropyrimidin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 7179614 |
| Molecular Formula | C12H22N7O3+ |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 2-[[4-amino-6-(4-ethylpiperazin-4-ium-1-yl)-5-nitropyrimidin-2-yl]amino]ethanol |
| SMILES | CC[NH+]1CCN(c2nc(NCCO)nc(N)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H21N7O3/c1-2-17-4-6-18(7-5-17)11-9(19(21)22)10(13)15-12(16-11)14-3-8-20/h20H,2-8H2,1H3,(H3,13,14,15,16)/p+1 |
| InChIKey | OQEQGJIHXTULMM-UHFFFAOYSA-O |
| XLogP | -1.90 |
| TPSA | 134.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|