C22H26N7O2+ — CID 7529917
2-N-benzyl-6-(4-benzylpiperazin-4-ium-1-yl)-5-nitropyrimidine-2,4-diamine (PubChem CID 7529917) has the molecular formula C22H26N7O2+ and a molecular weight of 420.50 g/mol. Its IUPAC name is 2-N-benzyl-6-(4-benzylpiperazin-4-ium-1-yl)-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-benzyl-6-(4-benzylpiperazin-4-ium-1-yl)-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 7529917 |
| Molecular Formula | C22H26N7O2+ |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 2-N-benzyl-6-(4-benzylpiperazin-4-ium-1-yl)-5-nitropyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCc2ccccc2)nc(N2CC[NH+](Cc3ccccc3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H25N7O2/c23-20-19(29(30)31)21(26-22(25-20)24-15-17-7-3-1-4-8-17)28-13-11-27(12-14-28)16-18-9-5-2-6-10-18/h1-10H,11-16H2,(H3,23,24,25,26)/p+1 |
| InChIKey | SHLGRJCPQSNGJV-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|