C20H27N7O3 — CID 3494968
6-(4-benzylpiperazin-1-yl)-5-nitro-2-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 3494968) has the molecular formula C20H27N7O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 6-(4-benzylpiperazin-1-yl)-5-nitro-2-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 6-(4-benzylpiperazin-1-yl)-5-nitro-2-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 3494968 |
| Molecular Formula | C20H27N7O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 6-(4-benzylpiperazin-1-yl)-5-nitro-2-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCC2CCCO2)nc(N2CCN(Cc3ccccc3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H27N7O3/c21-18-17(27(28)29)19(24-20(23-18)22-13-16-7-4-12-30-16)26-10-8-25(9-11-26)14-15-5-2-1-3-6-15/h1-3,5-6,16H,4,7-14H2,(H3,21,22,23,24) |
| InChIKey | JSQFTPXRKKWONE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|