C16H20N6O4 — CID 7509656
4-N-(2-methoxyphenyl)-5-nitro-2-N-[[(2R)-oxolan-2-yl]methyl]pyrimidine-2,4,6-triamine (PubChem CID 7509656) has the molecular formula C16H20N6O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is 4-N-(2-methoxyphenyl)-5-nitro-2-N-[[(2R)-oxolan-2-yl]methyl]pyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(2-methoxyphenyl)-5-nitro-2-N-[[(2R)-oxolan-2-yl]methyl]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 7509656 |
| Molecular Formula | C16H20N6O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 4-N-(2-methoxyphenyl)-5-nitro-2-N-[[(2R)-oxolan-2-yl]methyl]pyrimidine-2,4,6-triamine |
| SMILES | COc1ccccc1Nc1nc(NC[C@H]2CCCO2)nc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N6O4/c1-25-12-7-3-2-6-11(12)19-15-13(22(23)24)14(17)20-16(21-15)18-9-10-5-4-8-26-10/h2-3,6-7,10H,4-5,8-9H2,1H3,(H4,17,18,19,20,21)/t10-/m1/s1 |
| InChIKey | YIAJIGVIZWAYAT-SNVBAGLBSA-N |
| XLogP | 2.31 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|