C15H17FN6O3 — CID 7509536
4-N-(4-fluorophenyl)-5-nitro-2-N-[[(2R)-oxolan-2-yl]methyl]pyrimidine-2,4,6-triamine (PubChem CID 7509536) has the molecular formula C15H17FN6O3 and a molecular weight of 348.34 g/mol. Its IUPAC name is 4-N-(4-fluorophenyl)-5-nitro-2-N-[[(2R)-oxolan-2-yl]methyl]pyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(4-fluorophenyl)-5-nitro-2-N-[[(2R)-oxolan-2-yl]methyl]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 7509536 |
| Molecular Formula | C15H17FN6O3 |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 4-N-(4-fluorophenyl)-5-nitro-2-N-[[(2R)-oxolan-2-yl]methyl]pyrimidine-2,4,6-triamine |
| SMILES | Nc1nc(NC[C@H]2CCCO2)nc(Nc2ccc(F)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17FN6O3/c16-9-3-5-10(6-4-9)19-14-12(22(23)24)13(17)20-15(21-14)18-8-11-2-1-7-25-11/h3-6,11H,1-2,7-8H2,(H4,17,18,19,20,21)/t11-/m1/s1 |
| InChIKey | RSFDZDIOIMMXHV-LLVKDONJSA-N |
| XLogP | 2.44 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|