C17H23FN7O3+ — CID 7461429
4-N-(4-fluorophenyl)-2-N-(3-morpholin-4-ium-4-ylpropyl)-5-nitropyrimidine-2,4,6-triamine (PubChem CID 7461429) has the molecular formula C17H23FN7O3+ and a molecular weight of 392.42 g/mol. Its IUPAC name is 4-N-(4-fluorophenyl)-2-N-(3-morpholin-4-ium-4-ylpropyl)-5-nitropyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(4-fluorophenyl)-2-N-(3-morpholin-4-ium-4-ylpropyl)-5-nitropyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 7461429 |
| Molecular Formula | C17H23FN7O3+ |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 4-N-(4-fluorophenyl)-2-N-(3-morpholin-4-ium-4-ylpropyl)-5-nitropyrimidine-2,4,6-triamine |
| SMILES | Nc1nc(NCCC[NH+]2CCOCC2)nc(Nc2ccc(F)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22FN7O3/c18-12-2-4-13(5-3-12)21-16-14(25(26)27)15(19)22-17(23-16)20-6-1-7-24-8-10-28-11-9-24/h2-5H,1,6-11H2,(H4,19,20,21,22,23)/p+1 |
| InChIKey | IRZSVBPKDLTGRF-UHFFFAOYSA-O |
| XLogP | 0.57 |
| TPSA | 132.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|