C15H21ClN7O2+ — CID 7480450
3-[[4-amino-6-(4-chloroanilino)-5-nitropyrimidin-2-yl]amino]propyl-dimethylazanium (PubChem CID 7480450) has the molecular formula C15H21ClN7O2+ and a molecular weight of 366.83 g/mol. Its IUPAC name is 3-[[4-amino-6-(4-chloroanilino)-5-nitropyrimidin-2-yl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[4-amino-6-(4-chloroanilino)-5-nitropyrimidin-2-yl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7480450 |
| Molecular Formula | C15H21ClN7O2+ |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 3-[[4-amino-6-(4-chloroanilino)-5-nitropyrimidin-2-yl]amino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCNc1nc(N)c([N+](=O)[O-])c(Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H20ClN7O2/c1-22(2)9-3-8-18-15-20-13(17)12(23(24)25)14(21-15)19-11-6-4-10(16)5-7-11/h4-7H,3,8-9H2,1-2H3,(H4,17,18,19,20,21)/p+1 |
| InChIKey | WNDVKQXAINIJAI-UHFFFAOYSA-O |
| XLogP | 1.31 |
| TPSA | 123.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|