C18H17ClN6O3 — CID 3371327
2-N-(3-chlorophenyl)-4-N-(4-ethoxyphenyl)-5-nitropyrimidine-2,4,6-triamine (PubChem CID 3371327) has the molecular formula C18H17ClN6O3 and a molecular weight of 400.83 g/mol. Its IUPAC name is 2-N-(3-chlorophenyl)-4-N-(4-ethoxyphenyl)-5-nitropyrimidine-2,4,6-triamine.
| Compound Name | 2-N-(3-chlorophenyl)-4-N-(4-ethoxyphenyl)-5-nitropyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 3371327 |
| Molecular Formula | C18H17ClN6O3 |
| Molecular Weight | 400.83 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-N-(3-chlorophenyl)-4-N-(4-ethoxyphenyl)-5-nitropyrimidine-2,4,6-triamine |
| SMILES | CCOc1ccc(Nc2nc(Nc3cccc(Cl)c3)nc(N)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H17ClN6O3/c1-2-28-14-8-6-12(7-9-14)21-17-15(25(26)27)16(20)23-18(24-17)22-13-5-3-4-11(19)10-13/h3-10H,2H2,1H3,(H4,20,21,22,23,24) |
| InChIKey | HRDBHQDZQAVLDF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.83 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|