C19H26N6O3 — CID 7463225
2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-4-N-(4-ethoxyphenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 7463225) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-4-N-(4-ethoxyphenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-4-N-(4-ethoxyphenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 7463225 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-4-N-(4-ethoxyphenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CCOc1ccc(Nc2nc(N3C[C@H](C)C[C@H](C)C3)nc(N)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H26N6O3/c1-4-28-15-7-5-14(6-8-15)21-18-16(25(26)27)17(20)22-19(23-18)24-10-12(2)9-13(3)11-24/h5-8,12-13H,4,9-11H2,1-3H3,(H3,20,21,22,23)/t12-,13+ |
| InChIKey | ILDJFMOHKRDJRP-BETUJISGSA-N |
| XLogP | 3.59 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|