C18H24N6O2 — CID 7480535
2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-4-N-(3-methylphenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 7480535) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-4-N-(3-methylphenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-4-N-(3-methylphenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 7480535 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-4-N-(3-methylphenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | Cc1cccc(Nc2nc(N3C[C@@H](C)C[C@H](C)C3)nc(N)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H24N6O2/c1-11-5-4-6-14(8-11)20-17-15(24(25)26)16(19)21-18(22-17)23-9-12(2)7-13(3)10-23/h4-6,8,12-13H,7,9-10H2,1-3H3,(H3,19,20,21,22)/t12-,13-/m0/s1 |
| InChIKey | BTUAACAJJRSQLD-STQMWFEESA-N |
| XLogP | 3.50 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|