C18H23N5O3 — CID 7744792
N-(3-methoxyphenyl)-6-methyl-2-[(3S)-3-methylpiperidin-1-yl]-5-nitropyrimidin-4-amine (PubChem CID 7744792) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-6-methyl-2-[(3S)-3-methylpiperidin-1-yl]-5-nitropyrimidin-4-amine.
| Compound Name | N-(3-methoxyphenyl)-6-methyl-2-[(3S)-3-methylpiperidin-1-yl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 7744792 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-(3-methoxyphenyl)-6-methyl-2-[(3S)-3-methylpiperidin-1-yl]-5-nitropyrimidin-4-amine |
| SMILES | COc1cccc(Nc2nc(N3CCC[C@H](C)C3)nc(C)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H23N5O3/c1-12-6-5-9-22(11-12)18-19-13(2)16(23(24)25)17(21-18)20-14-7-4-8-15(10-14)26-3/h4,7-8,10,12H,5-6,9,11H2,1-3H3,(H,19,20,21)/t12-/m0/s1 |
| InChIKey | AMBDBFPNTDFOJW-LBPRGKRZSA-N |
| XLogP | 3.68 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|