C20H22N6O3 — CID 3501575
2-N-(3,4-dimethylphenyl)-4-N-(4-ethoxyphenyl)-5-nitropyrimidine-2,4,6-triamine (PubChem CID 3501575) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is 2-N-(3,4-dimethylphenyl)-4-N-(4-ethoxyphenyl)-5-nitropyrimidine-2,4,6-triamine.
| Compound Name | 2-N-(3,4-dimethylphenyl)-4-N-(4-ethoxyphenyl)-5-nitropyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 3501575 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 2-N-(3,4-dimethylphenyl)-4-N-(4-ethoxyphenyl)-5-nitropyrimidine-2,4,6-triamine |
| SMILES | CCOc1ccc(Nc2nc(Nc3ccc(C)c(C)c3)nc(N)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H22N6O3/c1-4-29-16-9-7-14(8-10-16)22-19-17(26(27)28)18(21)24-20(25-19)23-15-6-5-12(2)13(3)11-15/h5-11H,4H2,1-3H3,(H4,21,22,23,24,25) |
| InChIKey | OUXYWVQQIXBWNP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|