C17H21ClN6O2 — CID 7523759
2-N-(4-chlorophenyl)-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-5-nitropyrimidine-2,4-diamine (PubChem CID 7523759) has the molecular formula C17H21ClN6O2 and a molecular weight of 376.85 g/mol. Its IUPAC name is 2-N-(4-chlorophenyl)-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-(4-chlorophenyl)-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 7523759 |
| Molecular Formula | C17H21ClN6O2 |
| Molecular Weight | 376.85 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-N-(4-chlorophenyl)-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-5-nitropyrimidine-2,4-diamine |
| SMILES | C[C@@H]1C[C@@H](C)CN(c2nc(Nc3ccc(Cl)cc3)nc(N)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C17H21ClN6O2/c1-10-7-11(2)9-23(8-10)16-14(24(25)26)15(19)21-17(22-16)20-13-5-3-12(18)4-6-13/h3-6,10-11H,7-9H2,1-2H3,(H3,19,20,21,22)/t10-,11-/m1/s1 |
| InChIKey | HWJXTCYVPPJILE-GHMZBOCLSA-N |
| XLogP | 3.85 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.85 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|