C17H29N7O3 — CID 7544645
6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-2,4-diamine (PubChem CID 7544645) has the molecular formula C17H29N7O3 and a molecular weight of 379.47 g/mol. Its IUPAC name is 6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-2,4-diamine.
| Compound Name | 6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 7544645 |
| Molecular Formula | C17H29N7O3 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-2,4-diamine |
| SMILES | C[C@H]1C[C@H](C)CN(c2nc(NCCN3CCOCC3)nc(N)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C17H29N7O3/c1-12-9-13(2)11-23(10-12)16-14(24(25)26)15(18)20-17(21-16)19-3-4-22-5-7-27-8-6-22/h12-13H,3-11H2,1-2H3,(H3,18,19,20,21)/t12-,13-/m0/s1 |
| InChIKey | SNGVLDSKPBHPHY-STQMWFEESA-N |
| XLogP | 1.19 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|