C16H27N7O3 — CID 3521136
2-N-(3-morpholin-4-ylpropyl)-5-nitro-6-piperidin-1-ylpyrimidine-2,4-diamine (PubChem CID 3521136) has the molecular formula C16H27N7O3 and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-N-(3-morpholin-4-ylpropyl)-5-nitro-6-piperidin-1-ylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-morpholin-4-ylpropyl)-5-nitro-6-piperidin-1-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 3521136 |
| Molecular Formula | C16H27N7O3 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 2-N-(3-morpholin-4-ylpropyl)-5-nitro-6-piperidin-1-ylpyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCCCN2CCOCC2)nc(N2CCCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H27N7O3/c17-14-13(23(24)25)15(22-7-2-1-3-8-22)20-16(19-14)18-5-4-6-21-9-11-26-12-10-21/h1-12H2,(H3,17,18,19,20) |
| InChIKey | QGJHSJMCFSSGRX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|