C14H24N6O3 — CID 7522673
2-N-(3-methoxypropyl)-6-[(3R)-3-methylpiperidin-1-yl]-5-nitropyrimidine-2,4-diamine (PubChem CID 7522673) has the molecular formula C14H24N6O3 and a molecular weight of 324.39 g/mol. Its IUPAC name is 2-N-(3-methoxypropyl)-6-[(3R)-3-methylpiperidin-1-yl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-methoxypropyl)-6-[(3R)-3-methylpiperidin-1-yl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 7522673 |
| Molecular Formula | C14H24N6O3 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 2-N-(3-methoxypropyl)-6-[(3R)-3-methylpiperidin-1-yl]-5-nitropyrimidine-2,4-diamine |
| SMILES | COCCCNc1nc(N)c([N+](=O)[O-])c(N2CCC[C@@H](C)C2)n1 |
| InChI | InChI=1S/C14H24N6O3/c1-10-5-3-7-19(9-10)13-11(20(21)22)12(15)17-14(18-13)16-6-4-8-23-2/h10H,3-9H2,1-2H3,(H3,15,16,17,18)/t10-/m1/s1 |
| InChIKey | CTQOAYMQHMSXPI-SNVBAGLBSA-N |
| XLogP | 1.65 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|