C16H28N6O2 — CID 4921998
6-(3,5-dimethylpiperidin-1-yl)-2-N-(3-methylbutyl)-5-nitropyrimidine-2,4-diamine (PubChem CID 4921998) has the molecular formula C16H28N6O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 6-(3,5-dimethylpiperidin-1-yl)-2-N-(3-methylbutyl)-5-nitropyrimidine-2,4-diamine.
| Compound Name | 6-(3,5-dimethylpiperidin-1-yl)-2-N-(3-methylbutyl)-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 4921998 |
| Molecular Formula | C16H28N6O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 6-(3,5-dimethylpiperidin-1-yl)-2-N-(3-methylbutyl)-5-nitropyrimidine-2,4-diamine |
| SMILES | CC(C)CCNc1nc(N)c([N+](=O)[O-])c(N2CC(C)CC(C)C2)n1 |
| InChI | InChI=1S/C16H28N6O2/c1-10(2)5-6-18-16-19-14(17)13(22(23)24)15(20-16)21-8-11(3)7-12(4)9-21/h10-12H,5-9H2,1-4H3,(H3,17,18,19,20) |
| InChIKey | WDIKYMQIYVKIDU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|