C19H26N6O4 — CID 4918397
2-N-(2,5-dimethoxyphenyl)-6-(3,5-dimethylpiperidin-1-yl)-5-nitropyrimidine-2,4-diamine (PubChem CID 4918397) has the molecular formula C19H26N6O4 and a molecular weight of 402.46 g/mol. Its IUPAC name is 2-N-(2,5-dimethoxyphenyl)-6-(3,5-dimethylpiperidin-1-yl)-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-(2,5-dimethoxyphenyl)-6-(3,5-dimethylpiperidin-1-yl)-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 4918397 |
| Molecular Formula | C19H26N6O4 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 2-N-(2,5-dimethoxyphenyl)-6-(3,5-dimethylpiperidin-1-yl)-5-nitropyrimidine-2,4-diamine |
| SMILES | COc1ccc(OC)c(Nc2nc(N)c([N+](=O)[O-])c(N3CC(C)CC(C)C3)n2)c1 |
| InChI | InChI=1S/C19H26N6O4/c1-11-7-12(2)10-24(9-11)18-16(25(26)27)17(20)22-19(23-18)21-14-8-13(28-3)5-6-15(14)29-4/h5-6,8,11-12H,7,9-10H2,1-4H3,(H3,20,21,22,23) |
| InChIKey | DFPJNFKYQFGQPW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|