C12H12ClN5O4 — CID 4272021
2-chloro-4-N-(2,5-dimethoxyphenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 4272021) has the molecular formula C12H12ClN5O4 and a molecular weight of 325.71 g/mol. Its IUPAC name is 2-chloro-4-N-(2,5-dimethoxyphenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 2-chloro-4-N-(2,5-dimethoxyphenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 4272021 |
| Molecular Formula | C12H12ClN5O4 |
| Molecular Weight | 325.71 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-chloro-4-N-(2,5-dimethoxyphenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | COc1ccc(OC)c(Nc2nc(Cl)nc(N)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H12ClN5O4/c1-21-6-3-4-8(22-2)7(5-6)15-11-9(18(19)20)10(14)16-12(13)17-11/h3-5H,1-2H3,(H3,14,15,16,17) |
| InChIKey | KEZAXPDDSYJIMB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.71 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|