C16H21N5O4 — CID 23488685
6-N-(2,5-dimethoxyphenyl)-4-N,4-N-diethyl-5-nitropyrimidine-4,6-diamine (PubChem CID 23488685) has the molecular formula C16H21N5O4 and a molecular weight of 347.38 g/mol. Its IUPAC name is 6-N-(2,5-dimethoxyphenyl)-4-N,4-N-diethyl-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(2,5-dimethoxyphenyl)-4-N,4-N-diethyl-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23488685 |
| Molecular Formula | C16H21N5O4 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 6-N-(2,5-dimethoxyphenyl)-4-N,4-N-diethyl-5-nitropyrimidine-4,6-diamine |
| SMILES | CCN(CC)c1ncnc(Nc2cc(OC)ccc2OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H21N5O4/c1-5-20(6-2)16-14(21(22)23)15(17-10-18-16)19-12-9-11(24-3)7-8-13(12)25-4/h7-10H,5-6H2,1-4H3,(H,17,18,19) |
| InChIKey | ZSVRPOZPIAGKOM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|